@charset "UTF-8";
@import url("https://fonts.googleapis.com/earlyaccess/notosansjapanese.css");
html {
  font-size: 62.5%;
  overflow: auto;
  color: #00001a;
  font-family: "Noto Sans CJK JP", sans-serif; }

.bold{
    font-weight: bold;
}
.under-line {
    text-decoration: underline;
}
a {
  color: blue; }

/*[name] {
    margin-top:-72px!important;
    padding-top:72px!important;
}*/

img {
  vertical-align: bottom; }

body {
  overflow-x: hidden;
  width: 100%;
  min-width: 1260px;
  font-size: 14px;
  font-size: 1.4rem;
  color: #00001a;
  font-family: "Noto Sans CJK JP", sans-serif;
  line-height: 1.7;
  letter-spacing: .05em; }


h2 {
    font-size: 1.5em;
    font-weight: bold;
    display: block;
    margin-top: 40px;
    margin-bottom: 20px;
    border-left: solid .5em black;
    padding-left: .5em;
    border-bottom: solid 1px black; }

sup {
  font-size: .8em;
  position: relative;
  left: 0;
  bottom: .2em; }

sub {
  font-size: .8em;
  position: relative;
  left: 0;
  top: .2em; }

ul,
li {
  list-style-type: none; }

.nobr,
nobr {
  display: inline-block;
  white-space: nowrap; }

span, a {
  display: inline-block; }

label {
  cursor: pointer; }

input, button, select, textarea {
  margin: 10px 0; }

input:not([type="radio"]):not([type="checkbox"]):not([type="image"]), button, textarea, label > select, option {
  background: transparent;
  -webkit-border-image: none;
  outline: none;
  -webkit-box-shadow: none;
  box-shadow: none;
  border: none;
  -webkit-appearance: none;
  -webkit-rtl-ordering: logical; }

select::-ms-expand {
  display: none; }

input:not([type="submit"]):not([type="radio"]):not([type="checkbox"]):not([type="image"]), textarea {
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  padding: .5rem 1rem;
  border: solid 1px #d6d6d6;
  display: inline-block;
  width: auto; }

input:not([type="radio"]):not([type="checkbox"]):not([type="image"])[disabled], textarea[disabled] {
  background: rgba(64, 64, 64, 0.1);
  cursor: default; }

button, input[type="submit"], input[type="image"], select, option {
  cursor: pointer; }

button:focus, button::-moz-focus-inner, input[type='submit']:focus, input[type='submit']::-moz-focus-inner {
  border: 0;
  outline: none; }

input:not([type="submit"]):not([type="button"]):not([type="checkbox"]):not([type="radio"]):not([type="image"]),
select,
option,
textarea {
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  padding: 0 .5rem; }

input:not([type="submit"]):not([type="button"]):not([type="checkbox"]):not([type="radio"]):not([type="image"]),
select {
  display: inline-block;
  height: 3.2rem; }

select:not(.is-select) {
  color: rgba(0, 0, 0, 0.7); }

option[disabled] {
  color: transparent !important;
  opacity: 0 !important;
  display: none !important; }

.select {
  display: inline-block;
  position: relative; }

.select:after {
  content: "";
  display: inline-block;
  width: 10px;
  height: 10px;
  border-bottom: solid 2px gray;
  border-left: solid 2px gray;
  position: absolute;
  top: 50%;
  right: .5em;
  -webkit-transform: translate(-50%, -75%) rotate(-45deg);
  -ms-transform: translate(-50%, -75%) rotate(-45deg);
  transform: translate(-50%, -75%) rotate(-45deg);
  z-index: 0; }

.select select {
  width: 100%;
  z-index: 1;
  position: relative;
  padding-right: 2.5em;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  border: none;
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
  border: none;
  background: transparent; }

.select.disabled {
  background: #404040;
  opacity: .5;
  cursor: default; }

input[type="radio"]:not([class]) {
  width: 1em;
  height: 1em;
  z-index: 0;
  position: relative;
  visibility: hidden; }
  input[type="radio"]:not([class]) + label {
    padding-left: 1.8em;
    position: relative;
    left: -1em; }
    input[type="radio"]:not([class]) + label:before, input[type="radio"]:not([class]) + label:after {
      content: "";
      display: inline-block; }
    input[type="radio"]:not([class]) + label:before {
      width: 10px;
      height: 10px;
      border: solid 1px silver;
      border-radius: 50%;
      position: absolute;
      top: 50%;
      left: .7em;
      -webkit-transform: translate(-50%, -55%);
      -ms-transform: translate(-50%, -55%);
      transform: translate(-50%, -55%);
      background: white; }
  input[type="radio"]:not([class]):checked + label:after {
    width: 10px;
    height: 10px;
    background: gray;
    border: solid 3px white;
    -webkit-box-sizing: border-box;
    box-sizing: border-box;
    border-radius: 50%;
    position: absolute;
    top: 50%;
    left: .7em;
    -webkit-transform: translate(-50%, -55%);
    -ms-transform: translate(-50%, -55%);
    transform: translate(-50%, -55%);
    box-sizing: border-box; }

input[type="checkbox"]:not([class]) {
  width: 1em;
  height: 1em;
  background: red;
  z-index: 0;
  position: relative;
  visibility: hidden; }
  input[type="checkbox"]:not([class]) + label {
    padding-left: 1.4em;
    position: relative;
    left: -1.4em; }
    input[type="checkbox"]:not([class]) + label:before, input[type="checkbox"]:not([class]) + label:after {
      content: "";
      display: inline-block; }
    input[type="checkbox"]:not([class]) + label:before {
      width: 1em;
      height: 1em;
      border: solid 1px silver;
      position: absolute;
      left: -1px;
      top: -1px;
      background: white; }
  input[type="checkbox"]:not([class]):checked + label:after {
    width: .5em;
    height: .9em;
    border-right: solid 2px gray;
    border-bottom: solid 2px gray;
    -webkit-box-shadow: border-box;
    box-shadow: border-box;
    position: absolute;
    left: 0;
    top: 0;
    -webkit-transform: rotate(45deg);
    -ms-transform: rotate(45deg);
    transform: rotate(45deg);
    margin-left: .2em;
    margin-top: -.3em; }

/* ==================================================
    ???W???[??
================================================== */
/* --------------------------------------------------
  ????
-------------------------------------------------- */
.is-hide {
  display: none !important; }

.lts-n {
  letter-spacing: -.04em; }

.lts-ss {
  letter-spacing: -.08em; }

span[class*="lts-"] {
  display: inline; }

.f-half {
  width: .4em; }

.fz-ss {
  font-size: 0.6em !important; }

.fz-s {
  font-size: 0.85em !important; }

.fz-l {
  font-size: 1.2em !important; }

.fz-ll {
  font-size: 1.4em !important; }

.fz-lll {
  font-size: 1.6em !important; }

.ta-c {
  text-align: center !important; }

.ta-r {
  text-align: right !important; }

.ta-l {
  text-align: left !important; }

.ta-j {
  text-align: justify !important;
  text-justify: inter-ideograph !important;
  -webkit-font-feature-settings: "palt";
  font-feature-settings: "palt"; }

span.ta-c {
  display: inline-block;
  text-align: center !important; }

span.ta-r {
  display: inline-block;
  text-align: right !important; }

span.ta-l {
  display: inline-block;
  text-align: left !important; }

@media only screen and (max-width: 767px) {
  .sp-ta-c {
    text-align: center !important; }
  .sp-ta-r {
    text-align: right !important; }
  .sp-ta-l {
    text-align: left !important; } }

.va-m, .va-t, .va-b {
  display: table-cell !important; }

.va-m {
  vertical-align: middle !important; }

.va-t {
  vertical-align: top !important; }

.va-b {
  vertical-align: bottom !important; }

/*  margin
================================================== */
.mw-auto {
  margin-left: auto !important;
  margin-right: auto !important; }

.mt-0, .mh-0, .ma-0 {
  margin-top: 0rem !important; }

.mr-0, .mw-0, .ma-0 {
  margin-right: 0rem !important; }

.mb-0, .mh-0, .ma-0 {
  margin-bottom: 0rem !important; }

.ml-0, .mw-0, .ma-0 {
  margin-left: 0rem !important; }

.pt-0, .ph-0, .pa-0 {
  padding-top: 0rem !important; }

.pr-0, .pw-0, .pa-0 {
  padding-right: 0rem !important; }

.pb-0, .ph-0, .pa-0 {
  padding-bottom: 0rem !important; }

.pl-0, .pw-0, .pa-0 {
  padding-left: 0rem !important; }

.mt-5, .mh-5, .ma-5 {
  margin-top: 0.5rem !important; }

.mr-5, .mw-5, .ma-5 {
  margin-right: 0.5rem !important; }

.mb-5, .mh-5, .ma-5 {
  margin-bottom: 0.5rem !important; }

.ml-5, .mw-5, .ma-5 {
  margin-left: 0.5rem !important; }

.pt-5, .ph-5, .pa-5 {
  padding-top: 0.5rem !important; }

.pr-5, .pw-5, .pa-5 {
  padding-right: 0.5rem !important; }

.pb-5, .ph-5, .pa-5 {
  padding-bottom: 0.5rem !important; }

.pl-5, .pw-5, .pa-5 {
  padding-left: 0.5rem !important; }

.mt-10, .mh-10, .ma-10 {
  margin-top: 1rem !important; }

.mr-10, .mw-10, .ma-10 {
  margin-right: 1rem !important; }

.mb-10, .mh-10, .ma-10 {
  margin-bottom: 1rem !important; }

.ml-10, .mw-10, .ma-10 {
  margin-left: 1rem !important; }

.pt-10, .ph-10, .pa-10 {
  padding-top: 1rem !important; }

.pr-10, .pw-10, .pa-10 {
  padding-right: 1rem !important; }

.pb-10, .ph-10, .pa-10 {
  padding-bottom: 1rem !important; }

.pl-10, .pw-10, .pa-10 {
  padding-left: 1rem !important; }

.mt-15, .mh-15, .ma-15 {
  margin-top: 1.5rem !important; }

.mr-15, .mw-15, .ma-15 {
  margin-right: 1.5rem !important; }

.mb-15, .mh-15, .ma-15 {
  margin-bottom: 1.5rem !important; }

.ml-15, .mw-15, .ma-15 {
  margin-left: 1.5rem !important; }

.pt-15, .ph-15, .pa-15 {
  padding-top: 1.5rem !important; }

.pr-15, .pw-15, .pa-15 {
  padding-right: 1.5rem !important; }

.pb-15, .ph-15, .pa-15 {
  padding-bottom: 1.5rem !important; }

.pl-15, .pw-15, .pa-15 {
  padding-left: 1.5rem !important; }

.mt-20, .mh-20, .ma-20 {
  margin-top: 2rem !important; }

.mr-20, .mw-20, .ma-20 {
  margin-right: 2rem !important; }

.mb-20, .mh-20, .ma-20 {
  margin-bottom: 2rem !important; }

.ml-20, .mw-20, .ma-20 {
  margin-left: 2rem !important; }

.pt-20, .ph-20, .pa-20 {
  padding-top: 2rem !important; }

.pr-20, .pw-20, .pa-20 {
  padding-right: 2rem !important; }

.pb-20, .ph-20, .pa-20 {
  padding-bottom: 2rem !important; }

.pl-20, .pw-20, .pa-20 {
  padding-left: 2rem !important; }

.mt-25, .mh-25, .ma-25 {
  margin-top: 2.5rem !important; }

.mr-25, .mw-25, .ma-25 {
  margin-right: 2.5rem !important; }

.mb-25, .mh-25, .ma-25 {
  margin-bottom: 2.5rem !important; }

.ml-25, .mw-25, .ma-25 {
  margin-left: 2.5rem !important; }

.pt-25, .ph-25, .pa-25 {
  padding-top: 2.5rem !important; }

.pr-25, .pw-25, .pa-25 {
  padding-right: 2.5rem !important; }

.pb-25, .ph-25, .pa-25 {
  padding-bottom: 2.5rem !important; }

.pl-25, .pw-25, .pa-25 {
  padding-left: 2.5rem !important; }

.mt-30, .mh-30, .ma-30 {
  margin-top: 3rem !important; }

.mr-30, .mw-30, .ma-30 {
  margin-right: 3rem !important; }

.mb-30, .mh-30, .ma-30 {
  margin-bottom: 3rem !important; }

.ml-30, .mw-30, .ma-30 {
  margin-left: 3rem !important; }

.pt-30, .ph-30, .pa-30 {
  padding-top: 3rem !important; }

.pr-30, .pw-30, .pa-30 {
  padding-right: 3rem !important; }

.pb-30, .ph-30, .pa-30 {
  padding-bottom: 3rem !important; }

.pl-30, .pw-30, .pa-30 {
  padding-left: 3rem !important; }

.mt-35, .mh-35, .ma-35 {
  margin-top: 3.5rem !important; }

.mr-35, .mw-35, .ma-35 {
  margin-right: 3.5rem !important; }

.mb-35, .mh-35, .ma-35 {
  margin-bottom: 3.5rem !important; }

.ml-35, .mw-35, .ma-35 {
  margin-left: 3.5rem !important; }

.pt-35, .ph-35, .pa-35 {
  padding-top: 3.5rem !important; }

.pr-35, .pw-35, .pa-35 {
  padding-right: 3.5rem !important; }

.pb-35, .ph-35, .pa-35 {
  padding-bottom: 3.5rem !important; }

.pl-35, .pw-35, .pa-35 {
  padding-left: 3.5rem !important; }

.mt-40, .mh-40, .ma-40 {
  margin-top: 4rem !important; }

.mr-40, .mw-40, .ma-40 {
  margin-right: 4rem !important; }

.mb-40, .mh-40, .ma-40 {
  margin-bottom: 4rem !important; }

.ml-40, .mw-40, .ma-40 {
  margin-left: 4rem !important; }

.pt-40, .ph-40, .pa-40 {
  padding-top: 4rem !important; }

.pr-40, .pw-40, .pa-40 {
  padding-right: 4rem !important; }

.pb-40, .ph-40, .pa-40 {
  padding-bottom: 4rem !important; }

.pl-40, .pw-40, .pa-40 {
  padding-left: 4rem !important; }

.mt-45, .mh-45, .ma-45 {
  margin-top: 4.5rem !important; }

.mr-45, .mw-45, .ma-45 {
  margin-right: 4.5rem !important; }

.mb-45, .mh-45, .ma-45 {
  margin-bottom: 4.5rem !important; }

.ml-45, .mw-45, .ma-45 {
  margin-left: 4.5rem !important; }

.pt-45, .ph-45, .pa-45 {
  padding-top: 4.5rem !important; }

.pr-45, .pw-45, .pa-45 {
  padding-right: 4.5rem !important; }

.pb-45, .ph-45, .pa-45 {
  padding-bottom: 4.5rem !important; }

.pl-45, .pw-45, .pa-45 {
  padding-left: 4.5rem !important; }

.mt-50, .mh-50, .ma-50 {
  margin-top: 5rem !important; }

.mr-50, .mw-50, .ma-50 {
  margin-right: 5rem !important; }

.mb-50, .mh-50, .ma-50 {
  margin-bottom: 5rem !important; }

.ml-50, .mw-50, .ma-50 {
  margin-left: 5rem !important; }

.pt-50, .ph-50, .pa-50 {
  padding-top: 5rem !important; }

.pr-50, .pw-50, .pa-50 {
  padding-right: 5rem !important; }

.pb-50, .ph-50, .pa-50 {
  padding-bottom: 5rem !important; }

.pl-50, .pw-50, .pa-50 {
  padding-left: 5rem !important; }

/*  width
================================================== */
.w-0 {
  width: 0% !important; }

.w-5 {
  width: 5% !important; }

.w-10 {
  width: 10% !important; }

.w-15 {
  width: 15% !important; }

.w-20 {
  width: 20% !important; }

.w-25 {
  width: 25% !important; }

.w-30 {
  width: 30% !important; }

.w-35 {
  width: 35% !important; }

.w-40 {
  width: 40% !important; }

.w-45 {
  width: 45% !important; }

.w-50 {
  width: 50% !important; }

.w-55 {
  width: 55% !important; }

.w-60 {
  width: 60% !important; }

.w-65 {
  width: 65% !important; }

.w-70 {
  width: 70% !important; }

.w-75 {
  width: 75% !important; }

.w-80 {
  width: 80% !important; }

.w-85 {
  width: 85% !important; }

.w-90 {
  width: 90% !important; }

.w-95 {
  width: 95% !important; }

.w-100 {
  width: 100% !important; }

.px-100 {
  width: 100px !important; }

.px-105 {
  width: 105px !important; }

.px-110 {
  width: 110px !important; }

.px-115 {
  width: 115px !important; }

.px-120 {
  width: 120px !important; }

.px-125 {
  width: 125px !important; }

.px-130 {
  width: 130px !important; }

.px-135 {
  width: 135px !important; }

.px-140 {
  width: 140px !important; }

.px-145 {
  width: 145px !important; }

.px-150 {
  width: 150px !important; }

.px-155 {
  width: 155px !important; }

.px-160 {
  width: 160px !important; }

.px-165 {
  width: 165px !important; }

.px-170 {
  width: 170px !important; }

.px-175 {
  width: 175px !important; }

.px-180 {
  width: 180px !important; }

.px-185 {
  width: 185px !important; }

.px-190 {
  width: 190px !important; }

.px-195 {
  width: 195px !important; }

.px-200 {
  width: 200px !important; }

.px-205 {
  width: 205px !important; }

.px-210 {
  width: 210px !important; }

.px-215 {
  width: 215px !important; }

.px-220 {
  width: 220px !important; }

.px-225 {
  width: 225px !important; }

.mt-60 {
  margin-top: 60px !important; }

.pt-60 {
  padding-top: 60px !important; }

/* --------------------------------------------------
  ???C?A?E?g
-------------------------------------------------- */
.row {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  list-style-type: none;
  margin: 2rem -30px; }
  @media only screen and (min-width: 768px) and (max-width: 1259px) {
    .row {
      margin: 2rem -0.6rem; } }
  @media only screen and (max-width: 767px) {
    .row {
      margin: 2rem -0.5rem; } }
  .row__col {
    width: calc(100% - 60px);
    margin-left: 30px;
    margin-right: 30px;
    margin-bottom: 60px; }
    .row__col > *:last-child {
      margin-bottom: 0; }
  .row--col2 > .row__col {
    width: calc(50% - 60px); }
  .row--col3 > .row__col {
    width: calc(100% / 3 - 60px);
    max-width: calc(33% - 60px); }
  .row--col4 > .row__col {
    width: calc(25% - 60px); }
  .row--col5 > .row__col {
    width: calc(20% - 60px); }

/* --------------------------------------------------
  ?Z?N?V????
-------------------------------------------------- */
.section__inner > *:first-child {
  margin-top: 0; }

.section__inner > *:last-child {
  margin-bottom: 0; }

.section + .section {
  margin-top: 80px; }

.section:last-child {
  margin-bottom: 50px; }

.content--top .section {
  padding: 40px 0; }

/* --------------------------------------------------
  ???X?g
-------------------------------------------------- */
.list {
  line-height: 2; }
  .list li a {
    text-indent: initial; }
  .list li span {
    display: inline; }
  .list > li {
    list-style-type: none;
    text-indent: -1.5em;
    margin-left: 1.5em!important; }
    .list > li:before {
      content: '';
      display: inline-block;
      width: .2em;
      height: .2em;
      vertical-align: middle;
      background-color: #555;
      border-radius: 50%;
      text-indent: 0;
      margin-left: .6em;
      margin-right: .7em; }

.listNote {
  line-height: 2; }
  .listNote > li {
    padding-left: 1.5em; }
    .listNote > li:before {
      content: "??";
      width: 1.5em;
      display: inline-block;
      position: relative;
      margin-left: -1.5em; }

.listNoteNum {
  font-size: 12px;
  font-size: 1.2rem; }
  .listNoteNum > li {
    list-style-type: none;
    text-indent: -2em;
    margin-left: 2em;
    counter-increment: calc-ex9; }
    .listNoteNum > li:before {
      content: "??" counter(calc-ex9);
      display: inline-block;
      width: 2em;
      text-indent: 0; }

/* --------------------------------------------------
  ?o?i?[
-------------------------------------------------- */
.bnrs {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between; }

/* --------------------------------------------------
  ?y?[?W?l?[?V????
-------------------------------------------------- */
.pagenation {
  margin: 30px 0 30px;
  padding: 0;
  text-align: center; }
  .pagenation a {
    color: white; }
  .pagenation__btn a:hover {
    background-color: #cccccc;
    color: #ffffff; }
  .pagenation__list {
    letter-spacing: -.5em; }
  .pagenation__link {
    position: relative;
    letter-spacing: 0.04em;
    display: inline-block;
    margin: 0 4px;
    color: #333; }
  .pagenation__btn {
    letter-spacing: 0.04em;
    display: inline-block;
    margin: 0 7px; }
    .pagenation__btn a {
      display: inline-block;
      height: 40px;
      line-height: 40px;
      min-width: 40px;
      text-align: center;
      -webkit-box-sizing: border-box;
      box-sizing: border-box;
      font-size: 18px;
      font-size: 1.8rem;
      -webkit-transition: all .3s;
      -o-transition: all .3s;
      transition: all .3s;
      background-color: #d2d8e9;
      color: #1e3c91; }
  .pagenation .cur a {
    color: white;
    background-color: #1e3c91; }
  .pagenation__link {
    margin: 0 5px; }
    .pagenation__link a {
      -webkit-transition: all .3s;
      -o-transition: all .3s;
      transition: all .3s;
      padding: 10px 0; }
      .pagenation__link a:hover {
        opacity: .75; }
    .pagenation__link--first a {
      position: relative; }
      .pagenation__link--first a:before {
        content: "";
        display: block;
        position: absolute;
        top: 50%;
        left: 10px;
        width: .8em;
        height: .8em;
        border-top: solid 3px;
        border-right: solid 3px;
        border-color: #e9e9e9;
        -webkit-transform-origin: center;
        -ms-transform-origin: center;
        transform-origin: center;
        -webkit-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
        -ms-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
        transform: translateX(-50%) translateY(-50%) rotate(-135deg); }
      .pagenation__link--first a:after {
        content: "";
        display: block;
        position: absolute;
        top: 50%;
        left: 20px;
        width: .8em;
        height: .8em;
        border-top: solid 3px;
        border-right: solid 3px;
        border-color: #e9e9e9;
        -webkit-transform-origin: center;
        -ms-transform-origin: center;
        transform-origin: center;
        -webkit-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
        -ms-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
        transform: translateX(-50%) translateY(-50%) rotate(-135deg); }
    .pagenation__link--last a {
      position: relative; }
      .pagenation__link--last a:before {
        content: "";
        display: block;
        position: absolute;
        top: 50%;
        right: 10px;
        width: .8em;
        height: .8em;
        border-top: solid 3px;
        border-right: solid 3px;
        border-color: #e9e9e9;
        -webkit-transform-origin: center;
        -ms-transform-origin: center;
        transform-origin: center;
        -webkit-transform: translateX(50%) translateY(-50%) rotate(45deg);
        -ms-transform: translateX(50%) translateY(-50%) rotate(45deg);
        transform: translateX(50%) translateY(-50%) rotate(45deg); }
      .pagenation__link--last a:after {
        content: "";
        display: block;
        position: absolute;
        top: 50%;
        right: 20px;
        width: .8em;
        height: .8em;
        border-top: solid 3px;
        border-right: solid 3px;
        border-color: #e9e9e9;
        -webkit-transform-origin: center;
        -ms-transform-origin: center;
        transform-origin: center;
        -webkit-transform: translateX(50%) translateY(-50%) rotate(45deg);
        -ms-transform: translateX(50%) translateY(-50%) rotate(45deg);
        transform: translateX(50%) translateY(-50%) rotate(45deg); }
    .pagenation__link--prev {
      padding: 0; }
      .pagenation__link--prev a {
        color: transparent;
        position: relative;
        padding: .3rem 1rem; }
        .pagenation__link--prev a:before {
          content: "";
          display: block;
          position: absolute;
          top: 50%;
          right: .5em;
          width: .8em;
          height: .8em;
          border-top: solid 3px;
          border-right: solid 3px;
          border-color: #e9e9e9;
          -webkit-transform-origin: center;
          -ms-transform-origin: center;
          transform-origin: center;
          -webkit-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
          -ms-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
          transform: translateX(-50%) translateY(-50%) rotate(-135deg); }
    .pagenation__link--next {
      padding: 0; }
      .pagenation__link--next a {
        color: transparent;
        position: relative;
        padding: .3rem 1rem; }
        .pagenation__link--next a:before {
          content: "";
          display: block;
          position: absolute;
          top: 50%;
          left: .5em;
          width: .8em;
          height: .8em;
          border-top: solid 3px;
          border-right: solid 3px;
          border-color: #e9e9e9;
          -webkit-transform-origin: center;
          -ms-transform-origin: center;
          transform-origin: center;
          -webkit-transform: translateX(50%) translateY(-50%) rotate(45deg);
          -ms-transform: translateX(50%) translateY(-50%) rotate(45deg);
          transform: translateX(50%) translateY(-50%) rotate(45deg); }

/* --------------------------------------------------
  ??
-------------------------------------------------- */
.figure {
  overflow: hidden; }

/* --------------------------------------------------
  ???e?L?X?g
-------------------------------------------------- */
.lytImage {
  margin: 50px 0; }
  .lytImage:after {
    content: "";
    display: block;
    clear: both; }
  .lytImage__text span {
    display: inline; }
  .lytImage--imageLeft .lytImage__figure {
    float: left;
    padding-right: 30px; }
  .lytImage--imageRight .lytImage__figure {
    float: right;
    padding-left: 30px; }
  .lytImage .lytImage__figure {
    max-width: 50%;
    margin: 0; }
    .lytImage .lytImage__figure img {
      margin-bottom: 10px; }
    .lytImage .lytImage__figure figcaption p {
      margin: 0; }

figcaption p {
  font-size: 12px;
  font-size: 1.2rem; }

/* --------------------------------------------------
  ?????X?g
-------------------------------------------------- */
.dl01 dt {
  padding: 10px 20px;
  text-align: center;
  border: solid 1px #00001a;
  display: inline-block;
  min-width: 280px;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  margin-bottom: 15px; }

/* --------------------------------------------------
  ?A?C?R??
-------------------------------------------------- */
.icon {
  font-weight: bold;
  font-size: 14px;
  font-size: 1.4rem;
  padding: 0 3px;
  line-height: 1;
  margin: 0 15px; }
  .icon--inquired {
    background: #f7807e;
    border-radius: 3px;
    color: white;
    font-size: 12px;
    font-size: 1.2rem;
    padding: 3px 10px 2px; }

/* --------------------------------------------------
  ?e?L?X?g
-------------------------------------------------- */
.textNote {
  font-size: .8em; }

/* --------------------------------------------------
  ?t?H?[??
-------------------------------------------------- */
.tableForm {
  width: 100%;
  border-spacing: 1px;
  border-collapse: separate;
  background: #cccccc;
  margin: 40px 0 40px;
  border-collapse: separate;
  border-spacing: 1px;
  background: #cccccc;
  color: #555555;
  font-size: 14px;
  font-size: 1.4rem; }
  .tableForm tr th, .tableForm tr td {
    background: white;
    padding: 9px 15px;
    font-weight: normal;
    text-align: left; }
  .tableForm tr th {
    background: #f6f6f6;
    font-weight: bold;
    padding: 20px 15px;
    vertical-align: middle; }
  .tableForm tr td {
    vertical-align: middle; }
  .tableForm input {
    width: 300px !important;
    -webkit-box-sizing: border-box;
    box-sizing: border-box; }
  .tableForm input + *[class*="textNote"], .tableForm label + *[class*="textNote"], .tableForm select + *[class*="textNote"] {
    display: inline-block;
    margin: 0;
    margin-left: 10px; }

.innerList {
  margin: 20px 0;
  display: table;
  width: 100%; }
  .innerList > dt {
    display: table-cell;
    text-align: left;
    vertical-align: middle; }
    .innerList > dt:nth-of-type(1) {
      width: 20%; }
  .innerList > dt, .innerList > dd {
    display: table-cell;
    text-align: left;
    vertical-align: middle; }

input[type="radio"].radio {
  display: none; }
  input[type="radio"].radio + label {
    padding-left: 20px;
    position: relative;
    margin-right: 20px; }
  input[type="radio"].radio + label::before {
    content: "";
    display: block;
    position: absolute;
    top: 2px;
    left: 0;
    width: 14px;
    height: 14px;
    border: 1px solid #999;
    border-radius: 50%; }
  input[type="radio"].radio:checked + label::after {
    content: "";
    display: block;
    position: absolute;
    top: 5px;
    left: 3px;
    width: 10px;
    height: 10px;
    background: #b6b6b6;
    border-radius: 50%; }
  input[type="radio"].radio__text {
    font-size: 14px;
    font-size: 1.4rem; }

button.btnSubmit {
  border-radius: 0;
  border: none;
  display: table;
  margin: 20px  auto;
  background: #002f5f;
  height: 60px;
  color: white;
  font-size: 16px;
  font-size: 1.6rem;
  -webkit-transition: background .3s;
  -o-transition: background .3s;
  transition: background .3s;
  letter-spacing: .05em; }
  button.btnSubmit > span {
    min-width: 330px;
    display: table-cell;
    vertical-align: middle;
    text-align: center;
    -webkit-box-sizing: border-box;
    box-sizing: border-box; }
  button.btnSubmit:not([disabled]):hover {
    background: rgba(0, 47, 95, 0.5); }

.btnSubmit:not(button) {
  cursor: pointer;
  border-radius: 0;
  border: none;
  display: table;
  margin: 20px auto;
  background: #009f9d;
  height: 60px;
  color: white;
  font-size: 16px;
  font-size: 1.6rem;
  -webkit-transition: background .3s;
  -o-transition: background .3s;
  transition: background .3s;
  letter-spacing: .05em;
  position: relative;
  overflow: hidden; }
  .btnSubmit:not(button) input[type="submit"] {
    opacity: 0;
    position: absolute;
    top: 0;
    left: 0;
    width: 100%;
    height: 100%;
    z-index: 1;
    margin: 0;
    padding: 0; }
  .btnSubmit:not(button) > span {
    min-width: 330px;
    display: table-cell;
    vertical-align: middle;
    text-align: center;
    -webkit-box-sizing: border-box;
    box-sizing: border-box;
    position: relative;
    z-index: 0; }
  .btnSubmit:not(button):before {
    content: "";
    display: block;
    width: 100%;
    height: 100%;
    min-height: 60px;
    z-index: 0;
    background: #1e3c91;
    -webkit-transform-origin: left top;
    -ms-transform-origin: left top;
    transform-origin: left top;
    -webkit-transform: scale(0, 1);
    -ms-transform: scale(0, 1);
    transform: scale(0, 1);
    -webkit-transition: all .3s;
    -o-transition: all .3s;
    transition: all .3s;
    position: absolute;
    left: 0;
    top: 0; }
  .btnSubmit:not(button):not(.is-disabled):hover:before {
    -webkit-transform-origin: left top;
    -ms-transform-origin: left top;
    transform-origin: left top;
    -webkit-transform: scale(1, 1);
    -ms-transform: scale(1, 1);
    transform: scale(1, 1); }

/* --------------------------------------------------
  ?{?^??
-------------------------------------------------- */
.btn {
  min-width: 280px;
  text-align: center;
  height: 50px;
  display: table;
  margin: auto;
  font-weight: bold;
  font-size: 18px;
  font-size: 1.8rem;
  -webkit-transition: all .3s;
  -o-transition: all .3s;
  transition: all .3s; }
  .btn > span {
    display: table-cell;
    vertical-align: middle; }
  .btn:hover {
    text-decoration: none;
    opacity: .75; }
  .btn--01 {
    background: #fff000;
    color: #1e3c91; }
    .btn--01 > span > span {
      position: relative;
      padding: 0 1.8em; }
      .btn--01 > span > span:after {
        content: "";
        display: block;
        position: absolute;
        top: 50%;
        right: .5em;
        width: 8px;
        height: 8px;
        border-top: solid 2px;
        border-right: solid 2px;
        border-color: #1e3c91;
        -webkit-transform-origin: center;
        -ms-transform-origin: center;
        transform-origin: center;
        -webkit-transform: translateY(-50%) rotate(45deg);
        -ms-transform: translateY(-50%) rotate(45deg);
        transform: translateY(-50%) rotate(45deg); }
    .btn--01 .icon--window {
      margin-left: .2em;
      margin-top: -.4em;
      vertical-align: middle;
      display: inline-block; }
  .btn--02 {
    background: #1e3c91;
    color: white; }
    .btn--02 > span > span {
      position: relative;
      padding: 0 1.8em; }
      .btn--02 > span > span:after {
        content: "";
        display: block;
        position: absolute;
        top: 50%;
        right: .5em;
        width: 8px;
        height: 8px;
        border-top: solid 2px;
        border-right: solid 2px;
        border-color: white;
        -webkit-transform-origin: center;
        -ms-transform-origin: center;
        transform-origin: center;
        -webkit-transform: translateY(-50%) rotate(45deg);
        -ms-transform: translateY(-50%) rotate(45deg);
        transform: translateY(-50%) rotate(45deg); }
    .btn--02 .icon--window {
      margin-left: .2em;
      margin-top: -.4em;
      vertical-align: middle;
      display: inline-block; }
  .btn--380 {
    width: 380px; }
  .btn--back {
    background: #fff000;
    color: #1e3c91; }
    .btn--back > span > span {
      position: relative;
      padding: 0 1.8em; }
      .btn--back > span > span:after {
        content: "";
        display: block;
        position: absolute;
        top: 50%;
        left: .5em;
        width: 8px;
        height: 8px;
        border-top: solid 2px;
        border-right: solid 2px;
        border-color: #1e3c91;
        -webkit-transform-origin: center;
        -ms-transform-origin: center;
        transform-origin: center;
        -webkit-transform: translateY(-50%) rotate(-135deg);
        -ms-transform: translateY(-50%) rotate(-135deg);
        transform: translateY(-50%) rotate(-135deg); }
  .btn--request {
    background: #1e3c91;
    max-width: 800px;
    width: 100%;
    color: white; }

.label--01 {
  background: #1e3c91;
  color: white;
  font-size: 12px;
  font-size: 1.2rem;
  min-width: 117px;
  text-align: center;
  height: 22px;
  line-height: 22px; }

.label--02 {
  background: #1e3c91;
  color: white;
  font-size: 12px;
  font-size: 1.2rem;
  min-width: 156px;
  text-align: center;
  height: 27px;
  line-height: 27px; }

.btns {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center; }
  .btns .btn {
    margin: 0 50px; }

.important {
  width: 1200px;
  margin: 60px auto;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  border: solid 3px #ac2741;
  padding: 27px; }
  .important__title {
    font-size: 2.8rem;
    margin-bottom: 25px;
    text-align: center;
    border:none;
    padding: 0; }
  .important__table {
    width: 100%;
    margin: 0; }
    .important__table th, .important__table td {
      padding: 8px 0;
      font-size: 1.4rem;
      line-height: 25/14;
      font-weight: normal;
      vertical-align: top; }
      .important__table th a, .important__table td a {
        color: #ac2741; }
  .important__date {
    padding-right: 20px !important; }

.content--top .section__inner {
  width: 1260px;
  padding: 0 30px;
  margin: auto;
  -webkit-box-sizing: border-box;
  box-sizing: border-box; }

.sectionTitle {
  font-size: 4.2rem;
  line-height: 1.4;
  font-weight: bold;
  text-align: center;
  margin-bottom: 50px;
  border: none;
  padding: 0; }
  .sectionTitle span {
    position: relative;
    padding: 0 30px; }
    .sectionTitle span:before, .sectionTitle span:after {
      content: "";
      display: block;
      width: 8px;
      height: 8px;
      background: #1e3c91;
      -webkit-box-shadow: 4px 4px 0 0 #fff000;
      box-shadow: 4px 4px 0 0 #fff000;
      position: absolute;
      top: 50%;
      -webkit-transform: translateY(-50%) rotate(-45deg);
      -ms-transform: translateY(-50%) rotate(-45deg);
      transform: translateY(-50%) rotate(-45deg); }
    .sectionTitle span:before {
      left: 0; }
    .sectionTitle span:after {
      right: 8px; }

.section#banner .bannerSlide {
  margin-bottom: 50px; }

.section#banner .bannerSlide div {
  text-align: center; }
  .section#banner .bannerSlide div a {
    width: 100%;
    vertical-align: bottom; }

.section#banner .slick-arrow {
  font-size: 0;
  background: url(../img/common/btn-slidearrow.png) center no-repeat;
  background-size: cover;
  width: 40px;
  height: 40px;
  margin: 0;
  padding: 0;
  position: absolute;
  top: 50%;
  z-index: 1; }
  .section#banner .slick-arrow.slick-prev {
    left: 0;
    -webkit-transform: translate(-25%, -50%);
    -ms-transform: translate(-25%, -50%);
    transform: translate(-25%, -50%); }
  .section#banner .slick-arrow.slick-next {
    right: 0;
    -webkit-transform: translate(25%, -50%) rotate(180deg);
    -ms-transform: translate(25%, -50%) rotate(180deg);
    transform: translate(25%, -50%) rotate(180deg); }

.section#banner .slick-dots {
  margin: 0;
  padding-top: 20px;
  position: absolute;
  bottom: 0;
  left: 0;
  width: 100%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  -webkit-transform: translateY(100%);
  -ms-transform: translateY(100%);
  transform: translateY(100%); }
  .section#banner .slick-dots li {
    line-height: 0; }
    .section#banner .slick-dots li button {
      display: inline-block;
      background: #e5e5e5;
      font-size: 0;
      width: 37px;
      height: 13px;
      margin: 0 6px; }
    .section#banner .slick-dots li.slick-active button {
      background: #fff000; }

.section#pickup {
  padding: 50px 0 120px;
  background: url(../img/top/bg-pickup.png) center no-repeat;
  background-size: 100% 100%; }
  .section#pickup .pickupList {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: justify;
    -ms-flex-pack: justify;
    justify-content: space-between; }
  .section#pickup .pickupBox {
    text-decoration: none;
    color: #00001a;
    width: 265px; }
    .section#pickup .pickupBox figure {
      margin: 0;
      overflow: hidden;
      padding-bottom: 10px;
      padding-right: 10px;
      background: url(../img/top/bg-pickupBox.png) right bottom no-repeat; }
      .section#pickup .pickupBox figure span {
        overflow: hidden;
        max-width: 100%;
        vertical-align: bottom; }
        .section#pickup .pickupBox figure span img {
          -webkit-transition: all 1s ease;
          -o-transition: all 1s ease;
          transition: all 1s ease; }
    .section#pickup .pickupBox__date {
      font-size: 1.2rem;
      font-weight: bold;
      margin: 15px 0 0; }
    .section#pickup .pickupBox__text {
      font-size: 1.4rem;
      margin: 0; }
    .section#pickup .pickupBox:hover img {
      -webkit-transform: scale(1.2);
      -ms-transform: scale(1.2);
      transform: scale(1.2); }

.section#information {
  background: rgba(30, 60, 145, 0.1);
  padding: 100px 0 120px; }

.tab__list {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: start;
  -ms-flex-pack: start;
  justify-content: flex-start; }

.tab__hook {
  color: #1e3c91;
  font-size: 1.2rem;
  font-weight: bold;
  width: 130px;
  height: 40px;
  line-height: 37px;
  text-align: center;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  background: white;
  border: solid #1e3c91 3px;
  border-bottom: 0;
  position: relative;
  text-decoration: none; }
  .tab__hook:after {
    content: "";
    display: block;
    width: calc(100% + 6px);
    height: 100%;
    background: transparent;
    border-bottom: solid 3px white;
    position: absolute;
    bottom: 0;
    left: -3px; }
  .tab__hook:not(:first-child) {
    margin-left: 6px; }
  .tab__hook.is-active {
    background: #1e3c91;
    color: white; }
    .tab__hook.is-active:after {
      display: none; }

.tab__content {
  background: white;
  padding: 30px;
  border-top: solid 3px #1e3c91; }
  .tab__content:not(.is-active) {
    display: none; }
  .tab__content > *:first-child {
    margin-top: 0; }
  .tab__content > *:last-child {
    margin-bottom: 0; }

.list > li {
  margin: 1rem 0;
}
.list > li:first-child {
  margin: 0 0 1rem;
}
.list > li:last-child {
  margin: 1rem 0 0;
}

.linkList > li {
  margin: 1rem 0;
}
.linkList > li:first-child {
  margin: 0 0 1rem;
}
.linkList > li:last-child {
  margin: 1rem 0 0;
}

.linkList > li > a {
  position: relative;
  color: #00001a;
  padding-left: 1.5em; }
  .linkList > li > a:before {
    content: "";
    display: block;
    width: 0;
    height: 0;
    border-style: solid;
    border-width: .3em 0 .3em .35em;
    border-color: transparent transparent transparent #00001a;
    position: absolute;
    top: .6em;
    left: .5em; }

.newsList {
  margin: 0; }
  .newsList__item {
    margin: 45px 0; }
    .newsList__item:first-child {
      margin-top: 10px; }
    .newsList__item:last-child {
      margin-bottom: 10px; }

.newsLink {
  display: table;
  width: 100%;
  color: #00001a;
  -webkit-transition: all .5s;
  -o-transition: all .5s;
  transition: all .5s; }
  .newsLink:hover {
    -webkit-box-shadow: 0 0 20px 0 rgba(0, 0, 0, 0.2);
    box-shadow: 0 0 20px 0 rgba(0, 0, 0, 0.2);
    text-decoration: none; }
  .newsLink__figure, .newsLink__text {
    display: table-cell;
    vertical-align: top; }
  .newsLink .newsLink__figure {
    max-width: 100px;
    width: 100px;
    margin: 0;
    padding-right: 15px; }
  .newsLink__date {
    font-size: 1.2rem;
    font-weight: bold;
    line-height: 1.4;
    margin-bottom: 5px;
    display: inline-block; }
  .newsLink__label {
    font-size: 1.0rem;
    line-height: 1.4;
    background: #e5e5e5;
    color: #1e3c91;
    display: inline-block;
    padding: .2em .8em;
    margin-left: .5em;
    -webkit-transform: translateY(-10%);
    -ms-transform: translateY(-10%);
    transform: translateY(-10%); }
  .newsLink__title {
    font-size: 1.7rem;
    font-weight: bold;
    line-height: 1.4;
    margin-bottom: 8px; }
  .newsLink__head {
    margin-top: -5px;
    position: relative; }
  .newsLink__body {
    font-size: 1.4rem;
    line-height: 1.78571; }

.btn01 {
  min-width: 280px;
  height: 46px;
  padding: 2px 10px;
  position: relative;
  display: table;
  color: white;
  font-size: 1.4rem;
  font-weight: bold;
  text-decoration: none !important;
  -webkit-transition: all .3s;
  -o-transition: all .3s;
  transition: all .3s;
  margin: auto; }
  .btn01:hover {
    opacity: 0.75 !important; }
  .btn01 span {
    display: table-cell;
    vertical-align: middle;
    text-align: center;
    position: relative;
    z-index: 1;
    background: url(../img/common/arrow-btn01.png) right 20px center no-repeat;
    padding-right: 1rem; }
  .btn01:before, .btn01:after {
    content: "";
    display: block;
    width: 100%;
    height: 100%;
    position: absolute;
    -webkit-transform: skewX(-25deg);
    -ms-transform: skewX(-25deg);
    transform: skewX(-25deg);
    z-index: 0; }
  .btn01:before {
    background: #fff000;
    top: 2px;
    left: 2px; }
  .btn01:after {
    background: #1e3c91;
    top: -1px;
    left: -1px; }
  .btn01--back span {
    display: table-cell;
    vertical-align: middle;
    text-align: center;
    position: relative;
    z-index: 1;
    background: url(../img/common/arrow-btn01-back.png) left 20px center no-repeat;
    padding-left: 1rem; }
  .btn01--sis {
    min-width: 350px; }
  .btn01--elementary {
    min-width: 350px; }
  .btn01--hs {
    min-width: 350px; }
  .btn01--jh {
    min-width: 350px; }
  .btn01--seiwa_j_college {
    min-width: 350px; }
  .btn01--kindergarten {
    min-width: 300px; }
    .btn01--kindergarten span {
      background: url(../img/common/arrow-btn01-kindergarten.png) right 20px center no-repeat; }
    .btn01--kindergarten:before, .btn01--kindergarten:after {
      border-radius: 10px;
      -webkit-transform: skewX(0);
      -ms-transform: skewX(0);
      transform: skewX(0); }

#events {
  padding: 110px 0; }

.eventList {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  margin-bottom: 70px; }

.eventBox {
  max-width: 255px;
  text-decoration: none !important;
  color: black;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  -webkit-transition: all .5s;
  -o-transition: all .5s;
  transition: all .5s; }
  .eventBox:hover {
    -webkit-box-shadow: 0 0 20px 0 rgba(0, 0, 0, 0.2);
    box-shadow: 0 0 20px 0 rgba(0, 0, 0, 0.2); }
  .eventBox__date {
    background: #e8ebf4;
    border-right: solid 1px #00001a;
    padding: 8px;
    font-weight: bold;
    -webkit-box-sizing: border-box;
    /*width: 80px;*/
    box-sizing: border-box; }
    .eventBox__date > p {
      margin: 0;
      letter-spacing: 0;
      line-height: 1.1; }
    .eventBox__date__month {
      font-size: 1.2rem; }
    .eventBox__date__day {
      font-size: 2.4rem;
      text-align-last: justify;
      text-justify: inter-ideograph; }
    .eventBox__date__dotw {
      font-size: 1.2rem;
      text-align-last: justify;
      text-justify: inter-ideograph; }
  .eventBox__detail {
    padding-left: 10px; }
    .eventBox__detail > *:first-child {
      margin-top: 0; }
    .eventBox__detail > *:last-child {
      margin-bottom: 0; }
  .eventBox__label {
    line-height: 1;
    padding: 8px 30px;
    font-weight: bold;
    border: solid 1px #00001a;
    text-align: center;
    display: inline-block;
    font-size: 1.2rem;
    margin-bottom: 10px; }
  .eventBox__notice {
    color: #ac2741;
    line-height: 1;
    display: inline-block;
    font-size: 1.4rem;
    font-weight: bold;
    margin-bottom: 5px; }
  .eventBox__title {
    margin: 0 0 10px;
    font-size: 1.4rem;
    font-weight: bold;
    line-height: 25/14; }
  .eventBox__address {
    line-height: 1.4;
    font-size: 1.2rem;
    margin: 0 0 10px;
    padding-left: 15px;
    background: url(../img/common/icon-place.png) left top no-repeat; }
  .eventBox__target {
    line-height: 1.4;
    font-size: 1.2rem;
    margin: 0;
    padding-left: 15px;
    background: url(../img/common/icon-target.png) left top no-repeat; }

#movie {
  background: rgba(30, 60, 145, 0.1);
  padding: 110px 0 420px; }
  #movie .videoSlide {
    margin-bottom: 50px !important; }
    #movie .videoSlide iframe {
      vertical-align: bottom; }
    #movie .videoSlide .slick-list {
      overflow: visible; }
    #movie .videoSlide .slick-arrow {
      font-size: 0;
      background: url(../img/common/btn-slidearrow.png) center no-repeat;
      background-size: cover;
      width: 40px;
      height: 40px;
      margin: 0;
      padding: 0;
      position: absolute;
      top: 50%;
      z-index: 1; }
      #movie .videoSlide .slick-arrow.slick-prev {
        left: 0;
        -webkit-transform: translate(-50%, -50%);
        -ms-transform: translate(-50%, -50%);
        transform: translate(-50%, -50%); }
      #movie .videoSlide .slick-arrow.slick-next {
        right: 0;
        -webkit-transform: translate(50%, -50%) rotate(180deg);
        -ms-transform: translate(50%, -50%) rotate(180deg);
        transform: translate(50%, -50%) rotate(180deg); }
    #movie .videoSlide .slick-dots {
      margin: 0;
      padding-top: 20px;
      position: absolute;
      bottom: 0;
      left: 0;
      width: 100%;
      display: -webkit-box;
      display: -ms-flexbox;
      display: flex;
      -webkit-box-pack: center;
      -ms-flex-pack: center;
      justify-content: center;
      -webkit-transform: translateY(100%);
      -ms-transform: translateY(100%);
      transform: translateY(100%); }
      #movie .videoSlide .slick-dots li button {
        background: white;
        font-size: 0;
        width: 37px;
        height: 13px;
        margin: 0 6px; }
      #movie .videoSlide .slick-dots li.slick-active button {
        background: #fff000; }

#highscool {
  background: url(../img/top/bg-highscool.jpg) center bottom no-repeat;
  background-size: cover;
  padding: 0 0 60px;
  margin-top: -215px;
  text-align: center;
  -webkit-box-shadow: 0 0.5rem 0.5rem -0.5rem rgba(0, 0, 0, 0.4);
  box-shadow: 0 0.5rem 0.5rem -0.5rem rgba(0, 0, 0, 0.4);
  position: relative;
  z-index: 0; }
  #highscool a {
    margin-top: -100px; }
    #highscool a img {
      display: inline-block; }

#recomend-banner {
  background: white;
  padding: 25px 0; }
  #recomend-banner .bnrs {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: center;
    -ms-flex-pack: center;
    justify-content: center;
    -webkit-box-align: center;
    -ms-flex-align: center;
    align-items: center; }
  #recomend-banner .bnr {
    margin: 0 60px; }

.pageTitle {
  font-size: 42px;
  font-size: 4.2rem;
  line-height: 1.54762;
  font-weight: bold;
  margin-top: 80px;
  margin-bottom: 50px;
  padding-left: 42px;
  position: relative; }
  .pageTitle:before, .pageTitle:after {
    content: "";
    display: block;
    width: 6px;
    height: 28px;
    position: absolute;
    top: .82em;
    left: 4px;
    -webkit-transform: translateY(-50%) skewX(-30deg);
    -ms-transform: translateY(-50%) skewX(-30deg);
    transform: translateY(-50%) skewX(-30deg);
    background: #1e3c91;
    /*z-index: 1;*/ }
  .pageTitle:after {
    top: calc(.82em + 4px);
    left: 8px;
    background: #fff000;
    z-index: 0; }
  .pageTitle + .lead {
    margin-top: -35px; }
  .pageTitle__small {
    font-size: .5em; }

.lead {
  font-size: 17px;
  font-size: 1.7rem;
  margin-bottom: 60px; }

.indexBox {
  padding-bottom: 35px;
  text-decoration: none !important;
  position: relative;
  display: block;
  -webkit-transition: all .5s;
  -o-transition: all .5s;
  transition: all .5s; }
  .indexBox:after {
    content: "";
    display: block;
    clear: both; }
  .indexBox__figure {
    float: left;
    width: 200px;
    margin: 0; }
  .indexBox__text {
    padding-left: 220px;
    margin: 0;
    color: #00001a; }
    .indexBox__text dt {
      font-size: 21px;
      font-size: 2.1rem;
      font-weight: bold;
      color: #1e3c91; }
      .indexBox__text dt + dd {
        margin-top: 10px; }
  .indexBox__btn {
    background: #1e3c91;
    padding: .2em 1em .3em;
    color: white;
    position: absolute;
    bottom: 0;
    right: 0;
    font-size: 12px;
    font-size: 1.2rem; }
  .indexBox:hover {
    -webkit-box-shadow: 0 0 20px 0 rgba(0, 0, 0, 0.2);
    box-shadow: 0 0 20px 0 rgba(0, 0, 0, 0.2);
    text-decoration: none; }

.eventList {
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  margin-bottom: 20px; }
  .eventList--border .eventBox {
    margin-bottom: 60px;
    position: relative; }
    .eventList--border .eventBox:after {
      content: "";
      display: block;
      width: 100%;
      height: 1px;
      background: #e8ebf4;
      position: absolute;
      bottom: -30px;
      left: 0; }
    .eventList--border .eventBox:nth-child(n+5) {
      margin-top: 30px; }
  .eventList + .pagenation {
    margin-top: 0; }

.selectYearWrap:after {
  content: "";
  display: block;
  clear: both; }

.selectYear {
  float: right;
  margin-bottom: 20px;
  font-size: 1.2rem;
  position: relative; }
  .selectYear a {
    color: #00001a;
    text-decoration: none !important; }
  .selectYear__hook {
    padding-right: 1.5em;
    position: relative; }
    .selectYear__hook:after {
      content: "";
      display: block;
      width: 0;
      height: 0;
      border-style: solid;
      border-width: 8px 5px 0 5px;
      border-color: #00001a transparent transparent transparent;
      position: absolute;
      top: 50%;
      right: 0;
      -webkit-transform: translateY(-50%);
      -ms-transform: translateY(-50%);
      transform: translateY(-50%);
      -webkit-transition: all .3s;
      -o-transition: all .3s;
      transition: all .3s; }
    .selectYear__hook.is-open:after {
      -webkit-transform: translateY(-50%) rotate(180deg);
      -ms-transform: translateY(-50%) rotate(180deg);
      transform: translateY(-50%) rotate(180deg); }
  .selectYear__cont {
    position: absolute;
    bottom: 0;
    right: 0;
    -webkit-transform: translateY(100%);
    -ms-transform: translateY(100%);
    transform: translateY(100%);
    background: white;
    -webkit-box-shadow: 0 0 1rem 0 rgba(0, 0, 0, 0.2);
    box-shadow: 0 0 1rem 0 rgba(0, 0, 0, 0.2);
    min-width: 100%;
    -webkit-box-sizing: border-box;
    box-sizing: border-box;
    text-align: center;
    overflow: hidden;
    max-height: 0;
    -webkit-transition: all .3s;
    -o-transition: all .3s;
    transition: all .3s; }
    .selectYear__cont a {
      display: block;
      padding: .5em 1.5em;
      -webkit-transition: all .3s;
      -o-transition: all .3s;
      transition: all .3s; }
      .selectYear__cont a:hover {
        background: #e8ebf4; }
    .selectYear__cont.is-open {
      max-height: 10rem; }

.block {
  margin: 50px 0; }

.articleTitle {
  padding: 0 0 15px;
  border-bottom: solid 4px #e5e5e5;
  font-weight: bold;
  font-size: 28px;
  font-size: 2.8rem;
  margin-top: 85px;
  position: relative; }
  .articleTitle__label {
    font-weight: normal;
    font-size: 10px;
    font-size: 1rem;
    padding: .5em 1em;
    background: #e5e5e5;
    -webkit-transform: translateY(-10px);
    -ms-transform: translateY(-10px);
    transform: translateY(-10px);
    line-height: 1;
    color: #1e3c91; }
  .articleTitle__label2 {
    font-weight: normal;
    font-size: 12px;
    font-size: 1.2rem;
    padding: 7px 30px;
    border: solid 1px #00001a;
    -webkit-transform: translateY(-10px);
    -ms-transform: translateY(-10px);
    transform: translateY(-10px);
    line-height: 1;
    margin-bottom: 10px; }
  .articleTitle__date {
    font-size: 12px;
    font-size: 1.2rem;
    font-weight: normal;
    margin-left: 10px;
    -webkit-transform: translateY(-10px);
    -ms-transform: translateY(-10px);
    transform: translateY(-10px);
    line-height: 1; }
  .articleTitle:after {
    content: "";
    display: block;
    width: 100px;
    height: 4px;
    background: #1e3c91;
    position: absolute;
    bottom: -4px;
    left: 0; }

.social {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: end;
  -ms-flex-pack: end;
  justify-content: flex-end;
  margin-top: 10px;
  margin-bottom: 20px; }
  .social__btn {
    margin-left: 5px; }

.sectionTitle2 {
  text-align: left;
  font-size: 21px;
  font-size: 2.1rem;
  color: #1e3c91;
  font-weight: bold;
  letter-spacing: .1em; }

.blockTitle {
  font-size: 17px;
  font-size: 1.7rem;
  font-weight: bold;
  margin-bottom: 10px; }

.evendDescription {
  font-weight: bold;
  padding-bottom: 50px;
  margin-bottom: 50px;
  border-bottom: solid 1px #e5e5e5; }
  .evendDescription:after {
    content: "";
    display: block;
    clear: both; }
  .evendDescription dt {
    float: left; }

.linkBox {
  padding: 10px;
  padding-left: 65px;
  background: url(../img/common/icon-link.png) left center no-repeat;
  font-size: 1.4rem;
  font-weight: bold;
  text-decoration: none !important;
  color: #00001a;
  -webkit-transition: all .3s;
  -o-transition: all .3s;
  transition: all .3s; }
  .linkBox__sub {
    display: block!important;
    font-size: 1.2rem;
    font-weight: normal; }
  .linkBox:hover {
    opacity: .75; }

.linkBox.pdf {
  background: url(../img/common/icon-pdf.png) left center no-repeat;
 }
.linkBox.news {
  background: url(../img/common/icon-news.png) left center no-repeat;
 }
.linkBox.other {
  background: url(../img/common/icon-other.png) left center no-repeat;
 }
.linkBox.other_window {
  background: url(../img/common/icon-other_window.png) left center no-repeat;
 }
.linkBox.related {
  background: url(../img/common/icon-related.png) left center no-repeat;
 }
.linkBox.word {
  background: url(../img/common/icon-word.png) left center no-repeat;
 }
.linkBox.xls {
  background: url(../img/common/icon-xls.png) left center no-repeat;
 }


table[class^="table"] {
  border-collapse: separate;
  /*border-spacing: 1px;*/
  border-spacing: 0.1em;
  background: #e5e5e5; }
  table[class^="table"] th {
    background: #f3f3f3;
    padding: 25px; }
  table[class^="table"] td {
    background: white;
    padding: 25px; }
    table[class^="table"] th > *:first-child, table[class^="table"] td > *:first-child {
      margin-top: 0; }
    table[class^="table"] th > *:last-child, table[class^="table"] td > *:last-child {
      margin-bottom: 0; }

.table th {
  background: #fafafa; }

.table td {
  background: white; }

.table02 thead th {
  background: #fafafa; }

.table02 tbody th {
  font-weight: bold;
  background: white;
  text-align: left; }

.table02 tbody td {
  background: white; }

.table03 {
  border-collapse: collapse;
  border-spacing: 0;
  border: solid 1px #e5e5e5; }
  .table03 th, .table03 td {
    border-bottom: solid 1px #e5e5e5; }
  .table03 th {
    background: #fafafa;
    text-align: left;
    vertical-align: middle; }

.note {
  font-size: 1.2rem; }

.section#news {
  background: rgba(30, 60, 145, 0.1); }

#sis .section#news {
  padding-top: 100px;
  padding-bottom: 120px; }

#elementary .section#news {
  padding-top: 100px;
  padding-bottom: 120px; }

#jh .section#news {
  padding-top: 100px;
  padding-bottom: 120px; }

#hs .section#news {
  padding-top: 100px;
  padding-bottom: 120px; }

#seiwa_j_college .section#news {
  padding-top: 100px;
  padding-bottom: 120px; }

#kindergarten .section#news {
  padding-top: 100px;
  padding-bottom: 120px; }

.borderBox {
  border-top: solid 3px #1e3c91;
  padding: 30px;
  background: white; }

.indexBox2 {
  text-decoration: none !important;
  -webkit-box-shadow: 3px 3px 0 0 #fff000;
  box-shadow: 3px 3px 0 0 #fff000;
  background: #1e3c91; }
  .indexBox2__figure {
    margin: 0;
    overflow: hidden; }
    .indexBox2__figure img {
      -webkit-transition: all 1s ease;
      -o-transition: all 1s ease;
      transition: all 1s ease; }
  .indexBox2__text {
    margin: 0;
    text-align: center;
    color: white;
    font-size: 2.1rem;
    font-weight: bold;
    display: table;
    width: 100%;
    height: 118px; }
    .indexBox2__text > span {
      display: table-cell;
      vertical-align: middle; }
  .indexBox2:hover img {
    -webkit-transform: scale(1.2);
    -ms-transform: scale(1.2);
    transform: scale(1.2); }

#btnarea {
  padding: 80px 0;
  margin-bottom: 60px; }

.btns {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center; }
  .btns > * {
    margin: 0 30px; }

.largeBtn {
  min-width: 570px;
  height: 190px;
  padding: 2px 10px;
  position: relative;
  display: table;
  color: white;
  font-size: 4.2rem;
  font-weight: bold;
  text-decoration: none !important;
  -webkit-transition: all .3s;
  -o-transition: all .3s;
  transition: all .3s; }
  .largeBtn:hover {
    opacity: 0.75 !important; }
  .largeBtn span {
    display: table-cell;
    vertical-align: middle;
    text-align: center;
    position: relative;
    z-index: 1;
    background: url(../img/common/arrow-largeBtn-kindergarten.png) right 30px center no-repeat;
    padding-right: 1rem; }
  .largeBtn:before, .largeBtn:after {
    content: "";
    display: block;
    width: 100%;
    height: 100%;
    position: absolute;
    z-index: 0;
    border-radius: 10px; }
  .largeBtn:before {
    background: #fff000;
    top: 3px;
    left: 3px; }
  .largeBtn:after {
    background: #1e3c91;
    top: -2px;
    left: -2px; }

@media only screen and (min-width: 768px) {
  .is-sp {
    display: none !important; } }

@media only screen and (max-width: 767px) {
  .is-pc {
    display: none !important; } }

a,
span {

  display: inline-block; }

a > img {
  -webkit-transition: opacity .3s;
  -o-transition: opacity .3s;
  transition: opacity .3s; }

a:hover > img {
  opacity: .65; }
/*
@media only screen and (min-width: 768px) {
  img {
    max-width: 100%; } }
*/
img {max-width: 100%; }

body {
  margin: 0; }
  body.is-open {
    position: fixed; }

img[src*="icon-"] {
  vertical-align: middle; }

.mv {
  /*background: url(../img/top/mv.jpg) center no-repeat;*/
  background-size: cover!important;
  /*padding-top: 56.25%;*/
  font-size: 0; }

.js-sticky.is-fixed {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 10000;
  width: 100%;
  -webkit-transform: translateY(-120%);
  -ms-transform: translateY(-120%);
  transform: translateY(-120%);
  -webkit-box-shadow: 0 0 2rem rgba(0, 0, 0, 0.1);
  box-shadow: 0 0 2rem rgba(0, 0, 0, 0.1); }

.js-sticky.is-show {
  -webkit-transition: all 1s;
  -o-transition: all 1s;
  transition: all 1s;
  -webkit-transform: translateY(0);
  -ms-transform: translateY(0);
  transform: translateY(0); }

.js-slideIn {
  -webkit-transition: all .8s ease;
  -o-transition: all .8s ease;
  transition: all .8s ease;
  -webkit-transform: translateY(30px);
  -ms-transform: translateY(30px);
  transform: translateY(30px);
  opacity: 0; }
  .js-slideIn.is-slide {
    opacity: 1;
    -webkit-transform: translateY(0);
    -ms-transform: translateY(0);
    transform: translateY(0); }

.header {
  background: white;
  margin: auto;
  min-width: 1260px; }
  .header .header__primary {
    padding: 0 40px;
    padding-right: 0;
    background: #1e3c91; }
  .header__utility {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: end;
    -ms-flex-pack: end;
    justify-content: flex-end;
    -webkit-box-align: center;
    -ms-flex-align: center;
    align-items: center;
    font-size: 1.2rem;
    padding-left: 250px; }
    .header__utility a {
      color: white;
      padding: 0 10px; }
    .header__utility > * {
      height: 36px;
      line-height: 36px; }
  .header__languages {
    position: relative; }
    .header__languages__list {
      position: absolute;
      bottom: 0;
      right: 0;
      -webkit-transform: translateY(100%);
      -ms-transform: translateY(100%);
      transform: translateY(100%); }
  .header__langages__hook {
    position: relative;
    padding-right: 2em !important; }
    .header__langages__hook:after {
      content: "";
      display: block;
      width: 0;
      height: 0;
      border-style: solid;
      border-width: .6em .3em 0 .3em;
      border-color: white transparent transparent transparent;
      position: absolute;
      top: 50%;
      right: 1em;
      -webkit-transform: translateY(-50%);
      -ms-transform: translateY(-50%);
      transform: translateY(-50%);
      -webkit-transition: -webkit-transform .3s;
      transition: -webkit-transform .3s;
      -o-transition: transform .3s;
      transition: transform .3s;
      transition: transform .3s, -webkit-transform .3s; }
    .header__langages__hook.is-open:after {
      -webkit-transform: translateY(-50%) rotate(180deg);
      -ms-transform: translateY(-50%) rotate(180deg);
      transform: translateY(-50%) rotate(180deg); }
  .header__languages__list {
    max-height: 0;
    background: #1e3c91;
    z-index: 1;
    -webkit-box-shadow: 0 0 0.2rem 0 rgba(0, 0, 0, 0.2);
    box-shadow: 0 0 0.2rem 0 rgba(0, 0, 0, 0.2);
    overflow: hidden;
    -webkit-transition: max-height .3s;
    -o-transition: max-height .3s;
    transition: max-height .3s; }
    .header__languages__list.is-open {
      max-height: 100em; }
  .header__school {
    position: relative; }
    .header__school__hook {
      position: relative;
      padding-right: 2em !important; }
      .header__school__hook:after {
        content: "";
        display: block;
        width: 0;
        height: 0;
        border-style: solid;
        border-width: .6em .3em 0 .3em;
        border-color: white transparent transparent transparent;
        position: absolute;
        top: 50%;
        right: 1em;
        -webkit-transform: translateY(-50%);
        -ms-transform: translateY(-50%);
        transform: translateY(-50%);
        -webkit-transition: -webkit-transform .3s;
        transition: -webkit-transform .3s;
        -o-transition: transform .3s;
        transition: transform .3s;
        transition: transform .3s, -webkit-transform .3s; }
      .header__school__hook.is-open:after {
        -webkit-transform: translateY(-50%) rotate(180deg);
        -ms-transform: translateY(-50%) rotate(180deg);
        transform: translateY(-50%) rotate(180deg); }
    .header__school__list {
      position: absolute;
      bottom: 0;
      right: 0;
      -webkit-transform: translateY(100%);
      -ms-transform: translateY(100%);
      transform: translateY(100%);
      max-height: 0;
      background: #1e3c91;
      z-index: 100000;
      -webkit-box-shadow: 0 0 0.2rem 0 rgba(0, 0, 0, 0.2);
      box-shadow: 0 0 0.2rem 0 rgba(0, 0, 0, 0.2);
      overflow: hidden;
      -webkit-transition: max-height .3s;
      -o-transition: max-height .3s;
      transition: max-height .3s;
      white-space: nowrap; }
      .header__school__list a {
        display: block; }
      .header__school__list.is-open {
        max-height: 100em; }
  .header .search {
    border-left: solid 1px white;
    border-right: solid 1px white;
    padding: 0;
    position: relative; }
    .header .search__hook {
      padding: 0 10px;
      position: relative; }
      .header .search__hook:after {
        content: "";
        display: block;
        width: 0;
        height: 0;
        border-style: solid;
        border-width: 0 5px 8px 5px;
        border-color: transparent transparent #ffffff transparent;
        position: absolute;
        top: 50%;
        left: 50%;
        -webkit-transform: translate(-50%, -50%);
        -ms-transform: translate(-50%, -50%);
        transform: translate(-50%, -50%);
        opacity: 0; }
      .header .search__hook.is-open img {
        opacity: 0; }
      .header .search__hook.is-open:after {
        opacity: 1; }
    .header .search__cont {
      position: absolute;
      bottom: 0;
      right: -1px;
      -webkit-transform: translateY(100%);
      -ms-transform: translateY(100%);
      transform: translateY(100%);
      background: white;
      z-index: 10;
      border: solid 1px #e5e5e5;
      border-top: 0;
      -webkit-box-shadow: 0 0.2rem 0.4rem 0 rgba(0, 0, 0, 0.2);
      box-shadow: 0 0.2rem 0.4rem 0 rgba(0, 0, 0, 0.2);
      display: none; }
      .header .search__cont.is-open {
        display: block; }
      .header .search__cont form {
        position: relative;
        background: #1e3c91;
        width: 30rem; }
        .header .search__cont form input[type="text"] {
          height: 3.9rem !important;
          width: calc(100% - 34px) !important;
          vertical-align: top;
          margin: 0;
          border: none !important;
          background: white; }
        .header .search__cont form input[type="image"] {
          position: absolute;
          right: 1rem;
          top: 50%;
          -webkit-transform: translateY(-50%);
          -ms-transform: translateY(-50%);
          transform: translateY(-50%);
          margin: 0;
          z-index: 1; }
      .header .search__cont * {
        margin: 0; }
  .header a.contact {
    background: #fff000;
    color: #00001a; }
  .header__secondary {
    border-bottom: solid 1px #e5e5e5;
    padding: 8px 40px;
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: justify;
    -ms-flex-pack: justify;
    justify-content: space-between;
    -webkit-box-align: center;
    -ms-flex-align: center;
    align-items: center;
    position: relative; }
  .header__logo {
    margin-top: -45px;
    margin-bottom: -5px;
    background: white;
    padding-left: 50%;
    margin-left: calc(-50% - 60px);
    width: 280px; }
  .header__nav {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: end;
    -ms-flex-pack: end;
    justify-content: flex-end;
    -webkit-box-align: center;
    -ms-flex-align: center;
    align-items: center; }
    .header__nav a {
      margin: 0 10px;
      font-size: 1.2rem;
      font-weight: bold;
      color: #00001a; }
  .header--elementary .header__logo {
    width: 300px; }
  .header--jh .header__logo {
    width: 300px; }
  .header--hs .header__logo {
    width: 300px; }
  .header--seiwa_j_college .header__logo {
    width: 300px; }

.footer {
  margin: auto;
  background: url(../img/common/bg-footer.jpg) center no-repeat;
  background-size: cover!important;
  color: white; }
  .footer a {
    color: white; }
  .footer__inner {
    padding: 60px;
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: justify;
    -ms-flex-pack: justify;
    justify-content: space-between;
    -webkit-box-align: end;
    -ms-flex-align: end;
    align-items: flex-end; }
  .footer__primary {
    text-align: center; }
  .footer__secondaly {
    text-align: right; }
  .footer .footer__snsList {
    margin: 30px 0;
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: center;
    -ms-flex-pack: center;
    justify-content: center; }
  .footer .footer__sns {
    margin: 0 10px; }
  .footer__address {
    font-size: 1.2rem; }
  .footer .footer__nav {
    margin-top: 15px;
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: end;
    -ms-flex-pack: end;
    justify-content: flex-end; }
    .footer .footer__nav__item {
      font-size: 1.2rem; }
      .footer .footer__nav__item:not(:first-child) {
        position: relative;
        padding-left: 2em; }
        .footer .footer__nav__item:not(:first-child):before {
          content: "/";
          display: inline-block;
          position: absolute;
          left: .5em;
          top: 50%;
          -webkit-transform: translateY(-50%);
          -ms-transform: translateY(-50%);
          transform: translateY(-50%); }
  .footer__copyright {
    font-size: 1.2rem;
    font-weight: bold;
    margin-top: 30px; }
  .footer--sis .footer__address {
    margin-top: 30px; }
  .footer--elementary .footer__address {
    margin-top: 30px; }
  .footer--jh .footer__address {
    margin-top: 30px; }
  .footer--hs .footer__address {
    margin-top: 30px; }
  .footer--seiwa_j_college .footer__inner {
    -webkit-box-align: center;
    -ms-flex-align: center;
    align-items: center; }
    .footer--seiwa_j_college .footer__address .footer__sns {
      margin-top: 0;
      margin-right: 20px;
      margin-left: 0; }
    .footer--seiwa_j_college .footer__address p {
      margin: 0; }
  .footer--kindergarten .footer__address {
    margin-top: 10px;
    text-align: left; }
    .footer--kindergarten .footer__address .footer__sns {
      float: left;
      margin-top: 5px;
      margin-right: 20px;
      margin-left: 20px; }
  .footer--kindergarten .footer__copyright {
    margin-top: 60px; }

.footer > .btnPageTop {
  position: relative; }
  .footer > .btnPageTop .btnPageTop__hook {
    background: white;
    width: 40px;
    height: 40px;
    text-align: center;
    border: solid 2px #1e3c91;
    -webkit-box-sizing: border-box;
    box-sizing: border-box;
    font-size: 0px;
    font-size: 0rem;
    -webkit-transition: opacity .3s;
    -o-transition: opacity .3s;
    transition: opacity .3s; }
    .footer > .btnPageTop .btnPageTop__hook > span {
      padding-top: 28px;
      position: relative; }
      .footer > .btnPageTop .btnPageTop__hook > span:before {
        content: "";
        display: block;
        width: 14px;
        height: 14px;
        border-top: solid 2px #1e3c91;
        border-left: solid 2px #1e3c91;
        position: absolute;
        top: 50%;
        left: 50%;
        -webkit-transform: translateX(-50%) rotate(45deg);
        -ms-transform: translateX(-50%) rotate(45deg);
        transform: translateX(-50%) rotate(45deg); }
    .footer > .btnPageTop .btnPageTop__hook:hover {
      opacity: .65; }
  .footer > .btnPageTop .btnPageTop__hook:not(.is-fixed) {
    position: absolute;
    top: -30px;
    right: 20px;
    -webkit-transform: translateY(-100%);
    -ms-transform: translateY(-100%);
    transform: translateY(-100%); }
  .footer > .btnPageTop .btnPageTop__hook.is-fixed {
    position: fixed;
    bottom: 30px;
    right: 20px; }

.content:not(.content--top) {
  width: 1260px;
  padding: 20px 30px 70px;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  margin: auto; }

p, ul, dl, table, figure {
  margin: 20px 0; }

a {
  text-decoration: none; }
  a:hover {
    text-decoration: underline; }

.hero {
  overflow: hidden;
  position: relative;
  z-index: 0;
  max-width: 1200px;
  height: 606px;
  margin: auto; }
  .hero__title {
    position: absolute;
    top: 50%;
    left: 0;
    -webkit-transform: translateY(-50%);
    -ms-transform: translateY(-50%);
    transform: translateY(-50%);
    z-index: 10; }
  .hero__logo {
    position: absolute;
    top: 50%;
    left: 50%;
    -webkit-transform: translate(-50%, -50%);
    -ms-transform: translate(-50%, -50%);
    transform: translate(-50%, -50%);
    z-index: 10;
    text-align: center; }
    @media only screen and (min-width: 768px) {
      .hero__logo {
        margin-top: -10px; } }
  .hero__bg {
    position: absolute;
    z-index: 0;
    top: 0;
    right: 0;
    bottom: 0;
    left: 0;
    overflow: hidden;
    width: 100%;
    height: 100%; }
    .hero__bg__inner {
      position: relative;
      overflow: hidden;
      height: 100%; }
    .hero__bg__list {
      height: 100%; }
      .hero__bg__list__inner {
        position: relative;
        top: 0;
        left: 0;
        width: 100%;
        height: 100%; }
    .hero__bg__item {
      position: absolute;
      z-index: -1;
      top: 0;
      left: 0;
      display: none;
      overflow: hidden;
      width: 100%;
      height: 100%;
      -webkit-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1);
      transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1);
      background: #313131;
      background-position: center center;
      background-size: cover; }
      .hero__bg__item.is-active {
        display: block; }
  .hero__navs {
    position: absolute;
    bottom: 20px;
    left: 150px;
    width: 160px; }
    .hero__navs__inner {
      display: -webkit-box;
      display: -ms-flexbox;
      display: flex;
      -webkit-box-pack: justify;
      -ms-flex-pack: justify;
      justify-content: space-between;
      position: relative; }
  .hero__nav {
    color: #001a53;
    font-weight: bold;
    -webkit-transition: all .5s;
    -o-transition: all .5s;
    transition: all .5s; }
    .hero__nav.is-active {
      -webkit-transform: translateY(-20px);
      -ms-transform: translateY(-20px);
      transform: translateY(-20px); }
    .hero__nav span {
      position: relative; }
      .hero__nav span:before {
        content: "";
        display: block;
        width: 1px;
        height: 40px;
        background: #001a53;
        position: absolute;
        bottom: 0;
        left: 50%;
        -webkit-transform: translate(-50%, 100%);
        -ms-transform: translate(-50%, 100%);
        transform: translate(-50%, 100%); }

@-webkit-keyframes scaleUp {
  0% {
    -webkit-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1);
    -ms-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1);
    transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1); }
  100% {
    -webkit-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
    -ms-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
    transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7); } }

@keyframes scaleUp {
  0% {
    -webkit-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1);
    -ms-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1);
    transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1, 1, 1); }
  100% {
    -webkit-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
    -ms-transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
    transform: translate3d(0, 0, 0) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7); } }

.breadCrumb {
  line-height: 1.2; }
  .breadCrumb__list {
    letter-spacing: -.5em;
    margin: 0; }
  .breadCrumb__item {
    list-style-type: none;
    line-height: 1.2;
    letter-spacing: 0.04em;
    display: inline-block;
    padding-right: 25px;
    position: relative; }
  .breadCrumb__item:not(:last-child):after {
    content: "";
    display: block;
    position: absolute;
    top: 50%;
    right: 10px;
    margin-top: -3.5px;
    width: 6px;
    height: 6px;
    border-top: solid 1px;
    border-right: solid 1px;
    border-color: #333;
    -webkit-transform: rotate(45deg);
    -ms-transform: rotate(45deg);
    transform: rotate(45deg); }
  .breadCrumb__item a,
  .breadCrumb__item strong {
    text-decoration: none;
    font-size: 12px;
    font-size: 1.2rem;
    color: #00001a; }
  .breadCrumb__item a:hover {
    text-decoration: underline; }
  .breadCrumb__item strong {
    font-weight: normal;
    display: inline-block; }


.clearfix:after {
  display : block;
  clear : both;
  height : 0;
  content : ".";
  overflow : hidden;
}
.clearfix {
  zoom: 1;
}

.color-red {
    color: red;
}
.color-green {
    color: green;
}
.color-blue {
    color: blue;
}
.color-blue-dark {
    color: #000099;
}
.color-purple {
    color: #380096;
}
.color-red-01 {
    color: #C10435;
}


.paragraph {
  clear: both;
  overflow: hidden;
  margin-bottom: 50px;
}

.float_text {
  width: 100%;
}
.image_right img,
.image_left img,
.image_top img,
.image_bottom img {
  max-width: 100%;
}
.image_right,
.image_left,
.image_top,
.image_bottom {
  margin: 1em auto;
  max-width: 100%;
  text-align: center;
}


.sns li{
  float: left;
  overflow: hidden;
  *zoom: 1;
  margin: 0 20px 0 0;
}

.sns li:nth-child(2){
  width: 90px;
}

.sns li:nth-child(3){
  width: 60px;
}

.sns li:nth-child(4) img {
  vertical-align: top;
}

.fb_iframe_widget span {
  vertical-align: top!important;
}




.font-s_05 {
    font-size: .5em;
}
.font-s_06 {
    font-size: .6em;
}
.font-s_07 {
    font-size: .7em;
}
.font-s_08 {
    font-size: .8em;
}
.font-s_09 {
    font-size: .9em;
}
.font-l_01 {
    font-size: 1.1em;
}
.font-l_02 {
    font-size: 1.2em;
}
.font-l_03 {
    font-size: 1.3em;
}
.font-l_04 {
    font-size: 1.4em;
}
.font-l_05 {
    font-size: 1.5em;
}
.font-l_06 {
    font-size: 1.6em;
}
.font-l_07 {
    font-size: 1.7em;
}
.font-l_08 {
    font-size: 1.8em;
}
.font-l_09 {
    font-size: 1.9em;
}
.font-l_10 {
    font-size: 2em;
}


.font-size-mini {
    font-size: .9em;
}
h4.blockTitle {
    font-size: 1.6rem;
}
h5.blockTitle {
    font-size: 1.5rem;
}



/*      　PC版専用の表示                 */

@media print, screen and (min-width: 481px){
.image_right {
  float: right;
  margin: 0 0 0 30px;
  max-width: 400px;
　　}
.image_left {
  float: left;
  margin: 0 30px 0 0;
  max-width: 400px;
　　}
}

.sectionTitle2 + .blockTitle {
    margin-top: 1.5rem;
}

*:not(.sectionTitle2) + .blockTitle {
    margin-top: 4rem;
}

#editor, #editor_date {
    margin-bottom: 2rem;
}
.linkBox--pdf {
    background: url(../img/common/icon-pdf.png) left center no-repeat;
}
.linkBox--excel {
    background: url(../img/common/icon-xls.png) left center no-repeat;
}
.linkBox--word {
    background: url(../img/common/icon-word.png) left center no-repeat;
}
.linkBox--blank {
    background: url(../img/common/icon-related.png) left center no-repeat;
}
.linkBox--tab {
    background: url(../img/common/icon-other_window.png) left center no-repeat;
}
.linkBox--news {
    background: url(../img/common/icon-news.png) left center no-repeat;
}
.linkBox--file {
    background: url(../img/common/icon-other.png) left center no-repeat;
}
.linkXls--file {
    background: url(../img/common/icon-xls.png) left center no-repeat;
}
.linkBox--window {
  background: url(../img/common/icon-other_window.png) left center no-repeat;
}
.index{
  margin: 1rem 0;
}
.index p{
  margin: 0 0 .5rem; 
}
.index #index_box{
  border: solid gray 1px;
  padding: 1rem;
}
.index #index_box ul{
  letter-spacing: -.5em;
  margin: 0;
}
.index #index_box ul li{
  letter-spacing: normal;
  display: inline-block;
  margin: .5rem 0;
}
.index #index_box ul li:not(:last-child){
  margin-right: 2rem;
}
.index #index_box ul li a{
  position: relative;
  color: #00001a;
  padding-left: 1.5em;
}
.index #index_box ul li a:before{
  content: "";
  display: block;
  width: 0;
  height: 0;
  border-style: solid;
  border-width: .3em 0 .3em .35em;
  border-color: transparent transparent transparent #00001a;
  position: absolute;
  top: .6em;
  left: .5em;
}
.linkList--col2,
.linkList--col3,
.linkList--col4 {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  list-style-type: none;
  margin: 1rem -30px; }
  .linkList--col2 li,
  .linkList--col3 li,
  .linkList--col4 li {
    width: calc(100% - 60px);
    margin: 1rem 30px!important; }
  .linkList--col2 > li {
    width: calc(50% - 60px); }
  .linkList--col3 > li {
    width: calc(100% / 3 - 60px);
    max-width: calc(33% - 60px); }
  .linkList--col4 > li {
    width: calc(25% - 60px); }

/* ヘッダー */
#elementary .mv {
  background: url(../img/elementary/mv.jpg) center no-repeat;
}
#hs .mv,
#hs_english .mv{
  background: url(../img/hs/mv.jpg) center no-repeat;
}
#jh .mv {
  background: url(../img/jh/mv.jpg) center no-repeat;
}
#kindergarten .mv {
  background: url(../img/kindergarten/mv.jpg) center no-repeat;
}
#seiwa_j_college .mv {
  background: url(../img/seiwaj/mv.jpg) center no-repeat;
}
#sis .mv {
  background: url(../img/sis/mv.jpg) center no-repeat;
}
#kenkyu .mv {
  background: url(../img/kenkyu/mv.jpg) center no-repeat;
}

#a_affairs .mv {
  background: url(../img/a_affairs/mv.jpg) center no-repeat;
}
#c_child .mv {
  background: url(../img/c_child/mv.jpg) center no-repeat;
}
#c_christian .mv {
  background: url(../img/c_christian/mv.jpg) center no-repeat;
}
#c_cppo .mv {
  background: url(../img/c_cppo/mv.jpg) center no-repeat;
}
#c_hc .mv {
  background: url(../img/c_hc/mv.jpg) center no-repeat;
}
#c_hl .mv {
  background: url(../img/c_hl/mv.jpg) center no-repeat;
}
#c_language .mv {
  background: url(../img/c_language/mv.jpg) center no-repeat;
}
#c_shuwa .mv {
  background: url(/cms/kwansei_c_shuwa/img/mv.jpg) center no-repeat;
}
#c_teach .mv {
  background: url(../img/c_teach/mv.jpg) center no-repeat;
}
#c_volunteer .mv {
  background: url(../img/c_volunteer/mv.jpg) center no-repeat;
}
#cjle .mv {
  background: url(../img/cjle/mv.jpg) center no-repeat;
}
#f_health .mv {
  background: url(../img/f_health/mv.jpg) center no-repeat;
}
#f_sengari .mv {
  background: url(../img/f_sengari/mv.jpg) center no-repeat;
}
#g_language .mv {
  background: url(../img/g_language/mv.jpg) center no-repeat;
}
#gender .mv {
  background: url(../img/gender/mv.jpg) center no-repeat;
}
#giving .mv {
  background: url(../img/giving/mv.jpg) center no-repeat;
}
#highedu .mv {
  background: url(../img/highedu/mv.jpg) center no-repeat;
}
#i_asr .mv {
  background: url(../img/i_asr/mv.jpg) center no-repeat;
}
#i_industrial .mv {
  background: url(/cms/kwansei_i_industrial/img/mv.jpg) center no-repeat;
}
#kenkyu .mv {
  background: url(../img/kenkyu/mv.jpg) center no-repeat;
}
#kgac .mv {
  background: url(../img/kgac/mv.jpg) center no-repeat;
}
#lawschool .mv {
  background: url(../img/lawschool/mv.jpg) center no-repeat;
}
#nkc .mv {
  background: url(../img/nkc/mv.jpg) center no-repeat;
}
#r_human .mv {
  background: url(../img/r_human/mv.jpg) center no-repeat;
}
#s_ba .mv {
  background: url(../img/s_ba/mv.jpg) center no-repeat;
}
#s_economics .mv {
  background: url(../img/s_economics/mv.jpg) center no-repeat;
}
#s_education .mv {
  background: url(../img/s_education/mv.jpg) center no-repeat;
}
#s_humanities .mv {
  background: url(../img/s_humanities/mv.jpg) center no-repeat;
}
#s_hws .mv {
  background: url(../img/s_hws/mv.jpg) center no-repeat;
}
#s_is .mv {
  background: url(../img/s_is/mv.jpg) center no-repeat;
}
#s_law .mv {
  background: url(../img/s_law/mv.jpg) center no-repeat;
}
#s_policy .mv {
  background: url(../img/s_policy/mv.jpg) center no-repeat;
}
#s_sociology .mv {
  background: url(../img/s_sociology/mv.jpg) center no-repeat;
}
#s_theology .mv {
  background: url(../img/s_theology/mv.jpg) center no-repeat;
}
#shakairenkei .mv {
  background: url(../img/shakairenkei/mv.jpg) center no-repeat;
}
#sports .mv {
  background: url(/cms/kwansei_sports/mv.jpg) center no-repeat;
}
#students .mv {
  background: url(../img/students/mv.jpg) center no-repeat;
}
#t_marunouchi .mv {
  background: url(../img/t_marunouchi/mv.jpg) center no-repeat;
}
#unfa .mv {
  background: url(../img/unfa/mv.jpg) center no-repeat;
}
#c_rcc .mv {
  background: url(../img/c_rcc/mv.jpg) center no-repeat;
}
#koudai .mv {
  background: url(../img/koudai/mv.jpg) center no-repeat;
}
#admissions .mv {
  background: url(../img/admissions/mv.jpg) center no-repeat;
}
#ksc .mv {
  background: url(/cms/kwansei_ksc/img/mv.jpg) center no-repeat;
}
#wc .mv {
  background: url(/cms/kwansei_wc/img/mv.jpg) center no-repeat;
}

/* フッター */
#elementary .footer {
  background: url(../img/elementary/bg-footer.jpg) center no-repeat;
}
#hs .footer {
  background: url(../img/hs/bg-footer.jpg) center no-repeat;
}
#jh .footer {
  background: url(../img/jh/bg-footer.jpg) center no-repeat;
}
#kindergarten .footer {
  background: url(../img/kindergarten/bg-footer.jpg) center no-repeat;
}
#seiwa_j_college .footer {
  background: url(../img/seiwaj/bg-footer.jpg) center no-repeat;
}
#sis .footer {
  background: url(../img/sis/bg-footer.jpg) center no-repeat;
}
a:hover > img[src*="img-highscool.png"] {
  opacity: .8;
}
#jh #pickup-02 {
  background: url(../img/jh/bg-pickup.jpg) center bottom no-repeat;
  background-size: 100% auto;
  padding-bottom: 100px;
}
.pickupBox2{
  background: white;
  padding: 40px;
  text-decoration: none!important;
  color: #00001a;
  position: relative;
  -webkit-box-shadow: 10px 10px 0 0 #fff000;
  box-shadow: 10px 10px 0 0 #fff000;
  margin: auto;
  display: block;
  width: 1190px;
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
  box-sizing: border-box;
  transition: all .3s;
}
.pickupBox2:hover{
  opacity: .9;
}
.pickupBox2:hover img{
  opacity: 1;
}
.pickupBox2:after{
  content: "";
  display: block;
  clear: both;
}
.pickupBox2__logo{
  font-size: 72px;
  font-weight: bold;
  color: #fff000;
  position: absolute;
  top: -16px;
  left: 0;
  z-index: 0;
  line-height: 1;
}
.pickupBox2__image{
  float: left;
  position: relative;
  z-index: 1;
}
.pickupBox2__text{
  font-size: 18px;
  margin: 0 0 60px 430px;
}
.pickupBox2__btn{
  background: #1e3c91;
  color: white;
  font-size: 12px;
  padding: .2em 1em;
  position: absolute;
  bottom: 40px;
  right: 40px;
}
div.search__cont input[type="text"] {
    margin-top: 0 !important;
    padding-top: 0 !important;
}
html {
  font-family: "Noto Sans CJK JP", sans-serif!important;
}
.indexBoxRow.row--col3 {
  margin-left: -20px;
  margin-right: -20px;
}
.indexBoxRow.row--col3 > .row__col {
  width: calc(100% / 3 - 40px);
  max-width: calc(33% - 40px);
}
.indexBoxRow.row--col3 .row__col {
  width: calc(100% - 40px);
  margin-left: 20px;
  margin-right: 20px;
  margin-bottom: 60px;
}
.indexBoxRow.row--col3 .indexBox {
  padding-bottom: 0; 
}
.indexBoxRow.row--col3 .indexBox__figure {
  width: 100px;
}
.indexBoxRow.row--col3 .indexBox__text {
  padding-left: 110px;
  padding-bottom: 35px;
}
.indexBoxRow.row--col3 .indexBox__text dt {
  text-align: left;
}
/*.indexBoxRow.row--col3 .indexBox__btn {
  font-size: 0;
  height: 30px;
  width: 60px;
  background: #1e3c91 url(../img/common/arrow-btn01.png) center no-repeat;
}*/
.indexBoxRow.row--col3 .indexBox__btn {
  font-size: 0;
  width: 0;
  height: 0;
  background: none;
  border-style: solid;
  border-width: 0 0 20px 20px;
  border-color: transparent transparent #1e3c91 transparent;
}
/*.indexBoxRow.row--col3 .indexBox__btn {
  font-size: 0;
  width: 20px;
  height: 20px;
}
.indexBoxRow.row--col3 .indexBox__btn:before {
  content: "";
  display: inline-block;
  width: 0;
  height: 0;
  border-style: solid;
  border-width: 5px 0 5px 8px;
  border-color: transparent transparent transparent white;
  transform: translate(50%, 50%);
}*/
.songList li{
  margin: 20px 0;
  font-size: 1.7rem;
}
.songList li a{
  color: #00001a;
  padding-left: 25px;
  position: relative;
}
.songList li a:before{
  content: "";
  display: block;
  width: 15px;
  height: 15px;
  background: url(/cms/kwansei/img/common/icon-song.png) center no-repeat;
  -webkit-background-size: cover;
  background-size: cover;
  position: absolute;
  top: 50%;
  left: 0;
  transform: translateY(-50%);
}
.jasrac{
  font-size: 1.2rem;
  margin-top: -50px;
  transform: translateY(-100%);
  position: relative;
  z-index: -1;
}
.jasrac img{
  margin-left: 10px;
}
.songArea{}
.songArea__audio figcaption{
  font-size: 1.7rem;
  font-weight: bold;
  margin-bottom: 25px;
}
.songArea__text{
  margin: 30px 0;
  line-height: 1.8;
  padding-left: 25px;
  position: relative;
}
.songArea__text__num{
  width: 25px;
  position: absolute;
  left: 0;
  top: 0;
}

.btn02{
  background: #1e3c91;
  color: white;
  display: table;
}
.btn02 span{
  padding: .5em 1em;
  display: table-cell;
  vertical-align: middle;
  text-align: center;
}
/* 20200305 */
.kv{
  margin-top: -2rem;
  margin-bottom: 60px;
}
.kv img{
  width: 100%;
}
.indexList.row--col3 .row__col:nth-child(3n+1){
  padding: 0 25px 0 0;
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
  box-sizing: border-box;
}
.indexList.row--col3 .row__col:not(:nth-child(3n+1)){
  border-left: solid 1px #e5e5e5;
  padding: 0 25px;
  margin: 0;
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
  box-sizing: border-box;
}
.indexList.row--col3 .row__col:nth-child(3n+3){
  padding-right: 0;
}
.indexList.row--col3 .row__col:nth-child(1n+4){
  margin-top: 60px;
}
.indexList.row--col3 {
  margin-left: 0;
  margin-right: 0;
}
.indexList.row--col3 > .row__col {
  width: calc(100% / 3);
  max-width: 33%;
  margin-left: 0;
  margin-right: 0;
  margin-bottom: 0;
}
.indexBox3{
  position: relative;
  padding-bottom: 40px;
}
.indexBox3:after{
  content: "";
  display: block;
  clear: both;
}
.indexBox3__image{
  float: left;
}
.indexBox3__text{
  padding-left: 16rem;
  text-align: left;
  margin: 0;
}
.indexBox3__text dt{
  font-size: 1.65rem;
  line-height: 1.47;
  color: #1e3c91;
  font-weight: bold;
  margin-bottom: 15px;
}
.indexBox3__text dd{
  font-size: 1.4rem;
  line-height: 1.78;
}
.indexBox3__btn{
  background: #1e3c91;
  color: white;
  /*font-weight: bold;*/
  font-size: 1.3rem;
  height: 2em;
  line-height: 2em;
  padding: 0 .6em;
  position: absolute;
  right: 0;
  bottom: 0;
  transition: all .3s;
}
.indexBox3__btn[href*=".pdf"]{
  background: #cc0000;
}
.indexBox3__btn:hover{
  opacity: .65;
  text-decoration: none;
}
.archiveBox{
  text-align: center;
}
.archiveBox__figure{
  margin: 0;
}
.archiveBox__text p{
  font-size: 1.7rem;
  font-weight: bold;
  margin: 1.5rem 0;
}
.archiveBox__btn{
  background: #1e3c91;
  color: white;
  font-size: 1.3rem;
  height: 2em;
  line-height: 2em;
  padding: 0 .6em;
  transition: all .3s;
}
.archiveBox__btn[href*=".pdf"]{
  background: #cc0000;
}
.archiveBox__btn:hover{
  opacity: .65;
  text-decoration: none;
}

.acc{
  margin: 20px auto;
}
.acc__hook{
  display: block;
  padding: 15px 50px 15px 20px;
  border: 1px solid #1e3c91;
  text-decoration: none!important;
  color: #333;
  position: relative;
}
.acc__hook:before,
.acc__hook:after{
  content: "";
  display: block;
  width: 20px;
  height: 2px;
  background: #1e3c91;
  position: absolute;
  right: 15px;
  top: 50%;
  transform: translateY(-50%);
}
.acc__hook:before{
  transform: translateY(-50%) rotate(90deg);
  transition: all .3s;
}
.acc__hook.is-open:before{
  transform: translateY(-50%) rotate(0);
}
.acc__cont{
  max-height: 0;
  overflow: hidden;
  transition: all .3s;
}
.acc__cont.is-open{
  max-height: 100vh;
}
.acc__cont__inner{
  padding: 10px 20px;
}
.acc__cont__inner > *:first-child{
  margin-top: 0;
}
.acc__cont__inner > *:last-child{
  margin-bottom: 0;
}

.faq{}
.faq__q{
  display: inline-block;
  padding-left: 2em;
  position: relative;
}
.faq__q:before{
  content: "Q.";
  display: inline-block;
  width: 1.5em;
  text-indent: -2em;
  font-weight: bold;
  color: #1e3c91;
  position: absolute;
}
.faq__a{
  display: block;
  padding-left: 2em;
  position: relative;
}
.faq__a:before{
  content: "A.";
  display: inline-block;
  width: 1.5em;
  text-indent: -2em;
  font-weight: bold;
  color: #1e3c91;
  position: absolute;
}
.linkListBox{
  display: flex;
  flex-wrap: wrap;
  background-color: #ffffff;
  margin: -1px -.5px -1px;
}
.linkListBox li{
  width: calc(100% / 3 - 1px);
  margin: .5px;
}
.linkListBox li a{
  display: block;
  box-sizing: border-box;
  padding: 16px 40px 16px 16px;
  color: #333;
  text-decoration: none;
  transition: background-color .4s;
  background-color: #efefef;
  position: relative;
}
.linkListBox li a:before{
  content: "";
  display: block;
  width: .6em;
  height: .6em;
  border: solid 1px #333;
  border-width: 1px 1px 0 0;
  position: absolute;
  top: 50%;
  right: 20px;
  transform: translateY(-50%) rotate(45deg);
}
.mv__item.slick-slide img {
  width: 100%;
  max-width:100%;
}
.infoList__banneritem img{
  width: 100%;
  max-width:100%;
}
body[data-device="tab"] .megadrop__hook{
  pointer-events: none;
}
body[data-device="tab"] .megadrop__hook.megadrop_linkonly{
  pointer-events: auto !important;
}
body[data-device="tab"] .megadrop__hook:hover{
  text-decoration: none;
  color: white!important;
}